EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H41N5O9 |
| Net Charge | 0 |
| Average Mass | 651.717 |
| Monoisotopic Mass | 651.29043 |
| SMILES | CCC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)C(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C33H41N5O9/c1-4-27(41)24(15-21-16-34-23-13-9-8-12-22(21)23)35-31(44)26(17-39)37-32(45)28(19(3)40)38-30(43)18(2)29(42)36-25(33(46)47)14-20-10-6-5-7-11-20/h5-13,16,18-19,24-26,28,34,39-40H,4,14-15,17H2,1-3H3,(H,35,44)(H,36,42)(H,37,45)(H,38,43)(H,46,47)/t18?,19-,24+,25+,26+,28+/m1/s1 |
| InChIKey | KRIOFTHWUQTAOK-NELHGDMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter (ncbitaxon:42) | - | PubMed (26050527) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macyranone F (CHEBI:219164) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[3-[[(2S,3R)-3-hydroxy-1-[[(2S)-3-hydroxy-1-[[(2S)-1-(1H-indol-3-yl)-3-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-2-methyl-3-oxopropanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58825844 | ChemSpider |