EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43N5O11S |
| Net Charge | 0 |
| Average Mass | 669.754 |
| Monoisotopic Mass | 669.26798 |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)N[C@H](CS(=O)(=O)O)C(=O)N[C@@H]1C(=O)N[C@H]([C@H](O)C(C)C)C(=O)NCCC(=O)O[C@@H]1C |
| InChI | InChI=1S/C29H43N5O11S/c1-15(2)22(32-20(35)13-18-9-7-6-8-10-18)28(40)31-19(14-46(42,43)44)26(38)33-23-17(5)45-21(36)11-12-30-27(39)24(34-29(23)41)25(37)16(3)4/h6-10,15-17,19,22-25,37H,11-14H2,1-5H3,(H,30,39)(H,31,40)(H,32,35)(H,33,38)(H,34,41)(H,42,43,44)/t17-,19-,22+,23+,24-,25-/m1/s1 |
| InChIKey | QBVIHUUMLBEIRG-QFBVEMPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lincolnensis (ncbitaxon:1915) | - | PubMed (29557172) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cysteoamide (CHEBI:219160) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-3-[[(2R,3S,6R)-6-[(1R)-1-hydroxy-2-methylpropyl]-2-methyl-4,7,11-trioxo-1-oxa-5,8-diazacycloundec-3-yl]amino]-2-[[(2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]-3-oxopropane-1-sulonic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439498 | ChemSpider |