EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H43N5O9 |
| Net Charge | 0 |
| Average Mass | 665.744 |
| Monoisotopic Mass | 665.30608 |
| SMILES | CCC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)C(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)[C@@H](C)O)[C@H](C)O |
| InChI | InChI=1S/C34H43N5O9/c1-5-27(42)25(16-22-17-35-24-14-10-9-13-23(22)24)36-32(45)28(19(3)40)39-33(46)29(20(4)41)38-31(44)18(2)30(43)37-26(34(47)48)15-21-11-7-6-8-12-21/h6-14,17-20,25-26,28-29,35,40-41H,5,15-16H2,1-4H3,(H,36,45)(H,37,43)(H,38,44)(H,39,46)(H,47,48)/t18?,19-,20+,25-,26-,28-,29-/m0/s1 |
| InChIKey | HHPYBXDTISREJE-PVJKQRFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter (ncbitaxon:42) | - | PubMed (26050527) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macyranone E (CHEBI:219158) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[3-[[(2S,3R)-3-hydroxy-1-[[(2S,3S)-3-hydroxy-1-[[(2S)-1-(1H-indol-3-yl)-3-oxopentan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-2-methyl-3-oxopropanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58825843 | ChemSpider |