EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | O=C(O)/C=C\C=C\C=C/c1ccccc1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C18H16O4/c19-17(20)13-4-2-1-3-9-15-10-5-6-11-16(15)12-7-8-14-18(21)22/h1-14H,(H,19,20)(H,21,22)/b2-1+,9-3-,12-7+,13-4-,14-8+ |
| InChIKey | OJMDEDLCJJPJFR-IGBXNZRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (15387680) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E,6Z)-7-[2-[(1E,3E)-4-carboxybuta-1,3-dienyl]phenyl]hepta-2,4,6-trienoic acid (CHEBI:219149) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2Z,4E,6Z)-7-[2-[(1E,3E)-4-carboxybuta-1,3-dienyl]phenyl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435367 | ChemSpider |