EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10NO5P |
| Net Charge | 0 |
| Average Mass | 183.100 |
| Monoisotopic Mass | 183.02966 |
| SMILES | CC(=O)NC[C@@H](O)P(=O)(O)O |
| InChI | InChI=1S/C4H10NO5P/c1-3(6)5-2-4(7)11(8,9)10/h4,7H,2H2,1H3,(H,5,6)(H2,8,9,10)/t4-/m0/s1 |
| InChIKey | KYUPVSSKTOHMCL-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (24437999) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-acetamido-1-hydroxyethyl)phosphonic acid (CHEBI:219120) is a phosphonoacetic acid (CHEBI:15732) |
| IUPAC Name |
|---|
| [(1S)-2-acetamido-1-hydroxyethyl]phosphonic acid |
| Manual Xrefs | Databases |
|---|---|
| 61581951 | ChemSpider |