EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37N5O5 |
| Net Charge | 0 |
| Average Mass | 487.601 |
| Monoisotopic Mass | 487.27947 |
| SMILES | CCCCC/C=C/C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](/C=C/C(=O)O)CCCN=C(N)N |
| InChI | InChI=1S/C25H37N5O5/c1-2-3-4-5-6-9-22(32)30-21(17-18-10-13-20(31)14-11-18)24(35)29-19(12-15-23(33)34)8-7-16-28-25(26)27/h6,9-15,19,21,31H,2-5,7-8,16-17H2,1H3,(H,29,35)(H,30,32)(H,33,34)(H4,26,27,28)/b9-6+,15-12+/t19-,21-/m0/s1 |
| InChIKey | ANGGSYAIWRWBFA-VLQSCMNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sulfurospirillum barnesii (ncbitaxon:44674) | - | PubMed (29901979) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Barnesin A (CHEBI:219081) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (E,4S)-7-(diaminomethylideneamino)-4-[[(2S)-3-(4-hydroxyphenyl)-2-[[(E)-oct-2-enoyl]amino]propanoyl]amino]hept-2-enoic acid |