EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42ClN4O8 |
| Net Charge | +1 |
| Average Mass | 622.139 |
| Monoisotopic Mass | 621.26857 |
| SMILES | CC(C)C(O)C(NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C(Cc1ccc(O)c(Cl)c1)[N+](C)(C)C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H41ClN4O8/c1-16(2)26(38)25(29(41)32-17(3)30(42)43)34-27(39)22(14-18-7-10-20(36)11-8-18)33-28(40)23(35(4,5)6)15-19-9-12-24(37)21(31)13-19/h7-13,16-17,22-23,25-26,38H,14-15H2,1-6H3,(H5-,32,33,34,36,37,39,40,41,42,43)/p+1/t17-,22-,23?,25?,26?/m0/s1 |
| InChIKey | DJIZIWJIERJUPX-IIACXZLJSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies NRRL WC-3773 (ncbitaxon:1463936) | - | PubMed (29510029) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorotyrobetaine (CHEBI:219075) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [1-[[(2S)-1-[[1-[[(1S)-1-carboxyethyl]amino]-3-hydroxy-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-(3-chloro-4-hydroxyphenyl)-1-oxopropan-2-yl]-trimethylazanium |