EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN2O4 |
| Net Charge | 0 |
| Average Mass | 372.808 |
| Monoisotopic Mass | 372.08768 |
| SMILES | Cc1c(Cl)ccc(O)c1C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H17ClN2O4/c1-10-13(20)6-7-16(23)17(10)18(24)22-15(19(25)26)8-11-9-21-14-5-3-2-4-12(11)14/h2-7,9,15,21,23H,8H2,1H3,(H,22,24)(H,25,26)/t15-/m0/s1 |
| InChIKey | NYMYHEPTIAYLKM-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (25338006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Inducamide B (CHEBI:219072) has functional parent N-benzoylglycine (CHEBI:18089) |
| Inducamide B (CHEBI:219072) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2S)-2-[(3-chloro-6-hydroxy-2-methylbenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440507 | ChemSpider |