EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H43N4O8 |
| Net Charge | +1 |
| Average Mass | 587.694 |
| Monoisotopic Mass | 587.30754 |
| SMILES | CC(C)C(O)C(NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C(Cc1ccc(O)cc1)[N+](C)(C)C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H42N4O8/c1-17(2)26(37)25(29(40)31-18(3)30(41)42)33-27(38)23(15-19-7-11-21(35)12-8-19)32-28(39)24(34(4,5)6)16-20-9-13-22(36)14-10-20/h7-14,17-18,23-26,37H,15-16H2,1-6H3,(H5-,31,32,33,35,36,38,39,40,41,42)/p+1/t18-,23-,24?,25?,26?/m0/s1 |
| InChIKey | QFTDNMMLWLPCOY-VBRPOLMRSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies NRRL WC-3773 (ncbitaxon:1463936) | - | PubMed (29510029) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyrobetaine (CHEBI:219069) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [1-[[(2S)-1-[[1-[[(1S)-1-carboxyethyl]amino]-3-hydroxy-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-trimethylazanium |