EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 407.253 |
| Monoisotopic Mass | 406.04871 |
| SMILES | Cc1c(Cl)ccc(O)c1C(=O)N[C@@H](Cc1cnc2cc(Cl)ccc12)C(=O)O |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-9-13(21)4-5-16(24)17(9)18(25)23-15(19(26)27)6-10-8-22-14-7-11(20)2-3-12(10)14/h2-5,7-8,15,22,24H,6H2,1H3,(H,23,25)(H,26,27)/t15-/m0/s1 |
| InChIKey | BKHFTNHFLNCCGT-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (25338006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Inducamide A (CHEBI:219064) has functional parent N-benzoylglycine (CHEBI:18089) |
| Inducamide A (CHEBI:219064) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2S)-2-[(3-chloro-6-hydroxy-2-methylbenzoyl)amino]-3-(6-chloro-1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440506 | ChemSpider |