EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28N4O10 |
| Net Charge | 0 |
| Average Mass | 580.550 |
| Monoisotopic Mass | 580.18054 |
| SMILES | COc1c(O)c(O)c2c(c1O)-c1nc(C=C3C=Nc4ccccc43)c(O)n1C(C(=O)N[C@@H](CC(CO)CO)C(=O)O)C2 |
| InChI | InChI=1S/C28H28N4O10/c1-42-24-22(36)20-15(21(35)23(24)37)8-19(26(38)31-18(28(40)41)6-12(10-33)11-34)32-25(20)30-17(27(32)39)7-13-9-29-16-5-3-2-4-14(13)16/h2-5,7,9,12,18-19,33-37,39H,6,8,10-11H2,1H3,(H,31,38)(H,40,41)/t18-,19?/m0/s1 |
| InChIKey | YUQWCTIQZZQAKE-OYKVQYDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (29182847) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Imizoquin D (CHEBI:219063) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-4-(hydroxymethyl)-2-[[3,7,8,10-tetrahydroxy-2-(indol-3-ylidenemethyl)-9-methoxy-5,6-dihydroimidazo[2,1-a]isoquinoline-5-carbonyl]amino]pentanoic acid |