EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O5 |
| Net Charge | 0 |
| Average Mass | 250.250 |
| Monoisotopic Mass | 250.08412 |
| SMILES | CCC(=O)C(=O)c1c(C)cc(C(=O)O)cc1OC |
| InChI | InChI=1S/C13H14O5/c1-4-9(14)12(15)11-7(2)5-8(13(16)17)6-10(11)18-3/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | BBLZJLZMMLUHJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternariaspecies (ncbitaxon:1715220) | - | PubMed (25265160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrenochaetic acid H (CHEBI:219033) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3-methoxy-5-methyl-4-(2-oxobutanoyl)benzoic acid |