EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40N4O7 |
| Net Charge | 0 |
| Average Mass | 532.638 |
| Monoisotopic Mass | 532.28970 |
| SMILES | CC(C)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O[C@@H](CC(=O)O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C27H40N4O7/c1-16(2)24(28)26(36)31-12-8-11-20(31)21(14-23(33)34)38-27(37)19(13-18-9-6-5-7-10-18)30-22(32)15-29-25(35)17(3)4/h5-7,9-10,16-17,19-21,24H,8,11-15,28H2,1-4H3,(H,29,35)(H,30,32)(H,33,34)/t19-,20-,21-,24-/m0/s1 |
| InChIKey | PHGCGKYPFRBASZ-CIEVZJJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27809474) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rimosamide D (CHEBI:219007) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| (3S)-3-[(2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]-3-[(2S)-2-[[2-(2-methylpropanoylamino)acetyl]amino]-3-phenylpropanoyl]oxypropanoic acid |