EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:219000 - Rimosamide C
| Formula | C28H42N4O7 |
| Net Charge | 0 |
| Average Mass | 546.665 |
| Monoisotopic Mass | 546.30535 |
| SMILES | CCC(C)[C@H](N)C(=O)N1CCC[C@H]1[C@H](CC(=O)O)OC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)C(C)C |
| InChI | InChI=1S/C28H42N4O7/c1-5-18(4)25(29)27(37)32-13-9-12-21(32)22(15-24(34)35)39-28(38)20(14-19-10-7-6-8-11-19)31-23(33)16-30-26(36)17(2)3/h6-8,10-11,17-18,20-22,25H,5,9,12-16,29H2,1-4H3,(H,30,36)(H,31,33)(H,34,35)/t18?,20-,21-,22-,25-/m0/s1 |
| InChIKey | XOHAWTZWSLESAQ-BYMLLSERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27809474) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rimosamide C (CHEBI:219000) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| (3S)-3-[(2S)-1-[(2S)-2-amino-3-methylpentanoyl]pyrrolidin-2-yl]-3-[(2S)-2-[[2-(2-methylpropanoylamino)acetyl]amino]-3-phenylpropanoyl]oxypropanoic acid |