EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O5 |
| Net Charge | 0 |
| Average Mass | 358.394 |
| Monoisotopic Mass | 358.15287 |
| SMILES | CNc1cccc2c1C(=O)[C@@H]1C(=O)N(C(=O)CC(=O)OC)C(C)(C)[C@@H]1C2 |
| InChI | InChI=1S/C19H22N2O5/c1-19(2)11-8-10-6-5-7-12(20-3)15(10)17(24)16(11)18(25)21(19)13(22)9-14(23)26-4/h5-7,11,16,20H,8-9H2,1-4H3/t11-,16-/m1/s1 |
| InChIKey | PISDGLMTVUSQRK-BDJLRTHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (29271645) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperorydine J (CHEBI:218998) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 3-[(3aR,9aR)-1,1-dimethyl-5-(methylamino)-3,4-dioxo-9,9a-dihydro-3aH-benzo[]isoindol-2-yl]-3-oxopropanoate |
| Manual Xrefs | Databases |
|---|---|
| 78439484 | ChemSpider |