EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42N4O9 |
| Net Charge | 0 |
| Average Mass | 590.674 |
| Monoisotopic Mass | 590.29518 |
| SMILES | CC(=O)O[C@@H]1CCN(C(=O)[C@@H](N)C(C)C)[C@@H]1[C@H](CC(=O)O)OC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)C(C)C |
| InChI | InChI=1S/C29H42N4O9/c1-16(2)25(30)28(39)33-12-11-21(41-18(5)34)26(33)22(14-24(36)37)42-29(40)20(13-19-9-7-6-8-10-19)32-23(35)15-31-27(38)17(3)4/h6-10,16-17,20-22,25-26H,11-15,30H2,1-5H3,(H,31,38)(H,32,35)(H,36,37)/t20-,21+,22-,25-,26-/m0/s1 |
| InChIKey | GZJPRSNUTSZKES-QQCYLNIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27809474) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rimosamide B (CHEBI:218995) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| (3S)-3-[(2S,3R)-3-acetyloxy-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]-3-[(2S)-2-[[2-(2-methylpropanoylamino)acetyl]amino]-3-phenylpropanoyl]oxypropanoic acid |