EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H71N7O8 |
| Net Charge | 0 |
| Average Mass | 742.016 |
| Monoisotopic Mass | 741.53641 |
| SMILES | CCCCCCCCCC[C@@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCCC)NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](C)N)[C@@H](C)O)[C@@H](C)CC |
| InChI | InChI=1S/C37H71N7O8/c1-7-10-12-14-15-16-17-18-20-27(23-45)40-35(50)29(22-30(39)47)42-34(49)28(21-19-13-11-8-2)41-36(51)31(24(4)9-3)43-37(52)32(26(6)46)44-33(48)25(5)38/h24-29,31-32,45-46H,7-23,38H2,1-6H3,(H2,39,47)(H,40,50)(H,41,51)(H,42,49)(H,43,52)(H,44,48)/t24-,25+,26+,27-,28-,29-,31-,32+/m0/s1 |
| InChIKey | RKWVLPAISBWKHV-SYEIMXEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (27310134) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspercryptin A2 (CHEBI:218980) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2R,3R)-2-[[(2R)-2-aminopropanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]octanoyl]amino]-N-[(2S)-1-hydroxydodecan-2-yl]butanediamide |