EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34N6O4 |
| Net Charge | 0 |
| Average Mass | 494.596 |
| Monoisotopic Mass | 494.26415 |
| SMILES | NC(N)=NCCC[C@H](N=C(N)N)C(=O)[C@@H](Cc1ccccc1)C(=O)C[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H34N6O4/c27-25(28)31-13-7-12-21(32-26(29)30)23(34)20(15-18-10-5-2-6-11-18)22(33)16-19(24(35)36)14-17-8-3-1-4-9-17/h1-6,8-11,19-21H,7,12-16H2,(H,35,36)(H4,27,28,31)(H4,29,30,32)/t19-,20+,21+/m1/s1 |
| InChIKey | MJWKWTWOJQCUML-HKBOAZHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces mobaraensis (ncbitaxon:35621) | - | PubMed (27023439) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ketomemicin B3 (CHEBI:218962) is a benzenes (CHEBI:22712) |
| Ketomemicin B3 (CHEBI:218962) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| (2R,5S,7S)-2,5-dibenzyl-7,10-bis(diaminomethylideneamino)-4,6-dioxodecanoic acid |