EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H47ClN10O7 |
| Net Charge | 0 |
| Average Mass | 743.266 |
| Monoisotopic Mass | 742.33177 |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H]2C[C@@]3(O)c4ccc(Cl)cc4N[C@H]3N2C(=O)[C@H]2CCCNN2C(=O)[C@H](C)NC(=O)[C@H]2CCCNN2C(=O)[C@@H]2CCCNN2C1=O |
| InChI | InChI=1S/C34H47ClN10O7/c1-17(2)26-32(51)45-24(9-6-14-38-45)31(50)43-22(7-4-12-36-43)27(46)39-18(3)29(48)44-23(8-5-13-37-44)30(49)42-25(28(47)41-26)16-34(52)20-11-10-19(35)15-21(20)40-33(34)42/h10-11,15,17-18,22-26,33,36-38,40,52H,4-9,12-14,16H2,1-3H3,(H,39,46)(H,41,47)/t18-,22+,23+,24-,25-,26+,33-,34+/m0/s1 |
| InChIKey | NQBSPMKAIGEJBH-YMEHRBBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces alboflavus (ncbitaxon:67267) | - | PubMed (22365561) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NW-G05 (CHEBI:218949) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3R,10S,13R,20S,27R,30S,32R,40S)-36-chloro-32-hydroxy-10-methyl-27-propan-2-yl-1,7,8,11,17,18,24,25,28,39-decazaheptacyclo[28.10.0.03,8.013,18.020,25.032,40.033,38]tetraconta-33(38),34,36-triene-2,9,12,19,26,29-hexone |
| Manual Xrefs | Databases |
|---|---|
| 78442084 | ChemSpider |