EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2.CO2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | C=CC(C)(C)c1nc2cccc3c2c1C[C@H]1NC[C@H](C)[C@@H](C)[C@@H]31.O=C=O |
| InChI | InChI=1S/C21H28N2.CO2/c1-6-21(4,5)20-15-10-17-18(13(3)12(2)11-22-17)14-8-7-9-16(23-20)19(14)15;2-1-3/h6-9,12-13,17-18,22-23H,1,10-11H2,2-5H3;/t12-,13+,17+,18-;/m0./s1 |
| InChIKey | LRPXCXGKBFJKOI-ZMLIQXICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (25127024) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fumigaclavine H (CHEBI:218940) is a alkaloid (CHEBI:22315) |