EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H50N10O13 |
| Net Charge | 0 |
| Average Mass | 830.853 |
| Monoisotopic Mass | 830.35588 |
| SMILES | NC(=O)NCCCC(NC(=O)C(CCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O)C(=O)NC(CCCNC(N)=O)C(=O)NC1CCCN(O)C1=O |
| InChI | InChI=1S/C36H50N10O13/c37-35(57)40-16-4-10-22(32(54)44-23(11-5-17-41-36(38)58)33(55)45-24-12-6-18-46(59)34(24)56)43-31(53)21(42-30(52)20-8-2-14-26(48)28(20)50)9-3-15-39-29(51)19-7-1-13-25(47)27(19)49/h1-2,7-8,13-14,21-24,47-50,59H,3-6,9-12,15-18H2,(H,39,51)(H,42,52)(H,43,53)(H,44,54)(H,45,55)(H3,37,40,57)(H3,38,41,58) |
| InChIKey | QEKUWQJZGMGDSX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus rhodochrous (ncbitaxon:1829) | - | PubMed (17273817) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhodobactin (CHEBI:218937) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[5-[[5-(carbamoylamino)-1-[[5-(carbamoylamino)-1-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-4-[(2,3-dihydroxybenzoyl)amino]-5-oxopentyl]-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 78443692 | ChemSpider |