EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O |
| Net Charge | 0 |
| Average Mass | 324.468 |
| Monoisotopic Mass | 324.22016 |
| SMILES | C=CC(C)(C)c1nc2cccc3c2c1C[C@@H]1[C@@H]3[C@@H](O)[C@H](C)CN1C |
| InChI | InChI=1S/C21H28N2O/c1-6-21(3,4)20-14-10-16-18(19(24)12(2)11-23(16)5)13-8-7-9-15(22-20)17(13)14/h6-9,12,16,18-19,22,24H,1,10-11H2,2-5H3/t12-,16-,18-,19+/m1/s1 |
| InChIKey | VCXCXXJJHZVDSD-WTMJQUOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (25127024) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fumigaclavine E (CHEBI:218930) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6aR,9R,10S,10aR)-7,9-dimethyl-5-(2-methylbut-3-en-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-g]quinolin-10-ol |
| Manual Xrefs | Databases |
|---|---|
| 58828643 | ChemSpider |