EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | C=CC(C)(C)c1nc2cccc3c2c1C[C@H]1NC[C@@H](C)[C@H](OC(C)=O)[C@H]31 |
| InChI | InChI=1S/C22H28N2O2/c1-6-22(4,5)21-15-10-17-19(14-8-7-9-16(24-21)18(14)15)20(26-13(3)25)12(2)11-23-17/h6-9,12,17,19-20,23-24H,1,10-11H2,2-5H3/t12-,17-,19-,20+/m1/s1 |
| InChIKey | AKWYLWPBUAVOQG-OBGLBDJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (25127024) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fumigaclavine D (CHEBI:218924) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| [(6aR,9R,10S,10aR)-9-methyl-5-(2-methylbut-3-en-2-yl)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-g]quinolin-10-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 58828646 | ChemSpider |