EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CCCCCCC[C@@H]1OC(=O)c2cc(O)c(O)c(O)c21 |
| InChI | InChI=1S/C15H20O5/c1-2-3-4-5-6-7-11-12-9(15(19)20-11)8-10(16)13(17)14(12)18/h8,11,16-18H,2-7H2,1H3/t11-/m0/s1 |
| InChIKey | KSJWJETYRIELOC-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytosporaspecies (ncbitaxon:1715226) | - | PubMed (11112639) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cytosporone E (CHEBI:218905) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 3-heptyl-4,5,6-trihydroxy-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 8531765 | ChemSpider |