EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39NO |
| Net Charge | 0 |
| Average Mass | 405.626 |
| Monoisotopic Mass | 405.30316 |
| SMILES | CC1(C)[C@H](O)CC[C@@]2(C)[C@@H]3CC[C@@]4(C)c5cccc6ncc(c56)C[C@@H]4[C@@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C28H39NO/c1-25(2)20-9-13-28(5)21(27(20,4)14-11-23(25)30)10-12-26(3)18-7-6-8-19-24(18)17(16-29-19)15-22(26)28/h6-8,16,20-23,29-30H,9-15H2,1-5H3/t20-,21+,22+,23-,26+,27-,28+/m1/s1 |
| InChIKey | DRNNQNUPQAJBQZ-DIADYQGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus muricatus (ncbitaxon:469875) | - | DOI (10.1248/cpb.45.1694) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Petromindole (CHEBI:218897) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2R,5R,6S,9R,11S,14S,15R)-2,6,10,10,14-pentamethyl-19-azahexacyclo[15.6.1.02,15.05,14.06,11.020,24]tetracosa-1(24),17,20,22-tetraen-9-ol |
| Manual Xrefs | Databases |
|---|---|
| 154472 | ChemSpider |