EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O3 |
| Net Charge | 0 |
| Average Mass | 203.242 |
| Monoisotopic Mass | 203.12699 |
| SMILES | NCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17N3O3/c9-5-7(12)11-4-2-1-3-6(10)8(13)14/h6H,1-5,9-10H2,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | YOYBPHLYMUAKGZ-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-glycyl-L-lysine (CHEBI:21885) is a L-lysine derivative (CHEBI:25095) |
| N6-glycyl-L-lysine (CHEBI:21885) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| N6-glycyl-L-lysine |
| Synonym | Source |
|---|---|
| (2S)-2-amino-6-[(aminoacetyl)amino]hexanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1727121 | Beilstein |