EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N4O7 |
| Net Charge | 0 |
| Average Mass | 518.526 |
| Monoisotopic Mass | 518.18015 |
| SMILES | NC(=O)CC[C@H](NC(=O)/C=C/C=C/c1ccc([N+]([O-])=Nc2ccc(/C=C/C=C/C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H26N4O7/c28-24(32)18-17-23(27(36)37)29-25(33)7-3-1-5-20-11-15-22(16-12-20)31(38)30-21-13-9-19(10-14-21)6-2-4-8-26(34)35/h1-16,23H,17-18H2,(H2,28,32)(H,29,33)(H,34,35)(H,36,37)/b5-1+,6-2+,7-3+,8-4+,31-30?/t23-/m0/s1 |
| InChIKey | YUKFJTPWSMXPSM-PVRBKGJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (26623715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azoxymycin B (CHEBI:218845) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| [4-[(1E,3E)-5-[(4-amino-1-carboxy-4-oxobutyl)amino]-5-oxopenta-1,3-dienyl]phenyl]-[4-[(1E,3E)-4-carboxybuta-1,3-dienyl]phenyl]imino-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 78435760 | ChemSpider |