EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34N6O9 |
| Net Charge | 0 |
| Average Mass | 646.657 |
| Monoisotopic Mass | 646.23873 |
| SMILES | NC(=O)CCC(NC(=O)/C=C/C=C/c1ccc(N=[N+]([O-])c2ccc(/C=C/C=C/C(=O)NC(CCC(N)=O)C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H34N6O9/c33-27(39)19-17-25(31(43)44)35-29(41)7-3-1-5-21-9-13-23(14-10-21)37-38(47)24-15-11-22(12-16-24)6-2-4-8-30(42)36-26(32(45)46)18-20-28(34)40/h1-16,25-26H,17-20H2,(H2,33,39)(H2,34,40)(H,35,41)(H,36,42)(H,43,44)(H,45,46)/b5-1+,6-2+,7-3+,8-4+,38-37? |
| InChIKey | WSIYCVSSMDOSIR-WZOFXVQXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (26623715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azoxymycin A (CHEBI:218840) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| [4-[(1E,3E)-5-[(4-amino-1-carboxy-4-oxobutyl)amino]-5-oxopenta-1,3-dienyl]phenyl]-[4-[(1E,3E)-5-[(4-amino-1-carboxy-4-oxobutyl)amino]-5-oxopenta-1,3-dienyl]phenyl]imino-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 78435759 | ChemSpider |