EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | [H]C(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c8-6(7(11)12)3-1-2-4-9-5-10/h5-6H,1-4,8H2,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | KLPJXDPPMSJWKI-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-formyl-L-lysine (CHEBI:21884) is a N6-acyl-L-lysine (CHEBI:16232) |
| N6-formyl-L-lysine (CHEBI:21884) is a formamides (CHEBI:24079) |
| N6-formyl-L-lysine (CHEBI:21884) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| N6-formyl-L-lysine residue (CHEBI:156064) is substituent group from N6-formyl-L-lysine (CHEBI:21884) |
| IUPAC Name |
|---|
| N6-formyl-L-lysine |
| Synonym | Source |
|---|---|
| Nε-formyllysine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2413365 | Reaxys |
| CAS:1190-48-3 | ChemIDplus |
| Citations |
|---|