EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N2O6 |
| Net Charge | 0 |
| Average Mass | 538.685 |
| Monoisotopic Mass | 538.30429 |
| SMILES | COC(=O)CNC(=O)/C=C\C/C=C\NC(=O)/C=C(C)/C=C/C(C)C(OC)C(C)C(/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C31H42N2O6/c1-23(21-29(35)32-20-12-8-11-15-28(34)33-22-30(36)38-5)16-17-24(2)31(39-6)25(3)27(37-4)19-18-26-13-9-7-10-14-26/h7,9-21,24-25,27,31H,8,22H2,1-6H3,(H,32,35)(H,33,34)/b15-11-,17-16+,19-18+,20-12-,23-21+ |
| InChIKey | XHTUDGVBJDVOEZ-WKRSYQPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces crocatus (ncbitaxon:52) | - | PubMed (7928673) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crocacin (CHEBI:218828) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-[[(2Z,5Z)-6-[[(2E,4E,10E)-7,9-dimethoxy-3,6,8-trimethyl-11-phenylundeca-2,4,10-trienoyl]amino]hexa-2,5-dienoyl]amino]acetate |
| Manual Xrefs | Databases |
|---|---|
| 8500423 | ChemSpider |