EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29NO10 |
| Net Charge | 0 |
| Average Mass | 563.559 |
| Monoisotopic Mass | 563.17915 |
| SMILES | COc1cc(O)c2c(O)c3c(c4c2c1[C@]1(C4)C(C)=CCCC1(C)C)C(=O)[C@@]1(O)CC(=O)C(C(N)=O)=C(O)[C@@]1(O)C3=O |
| InChI | InChI=1S/C30H29NO10/c1-11-6-5-7-27(2,3)28(11)9-12-16-18(13(32)8-15(41-4)21(16)28)22(34)20-17(12)23(35)29(39)10-14(33)19(26(31)38)24(36)30(29,40)25(20)37/h6,8,32,34,36,39-40H,5,7,9-10H2,1-4H3,(H2,31,38)/t28-,29-,30+/m0/s1 |
| InChIKey | WUFPHUQCGWRGKE-OIFRRMEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (19168978) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-viridicatumtoxin B (CHEBI:218823) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4'R,6S,9'S)-4',8',9',12',14'-pentahydroxy-16'-methoxy-1,5,5-trimethyl-3',6',10'-trioxospiro[cyclohexene-6,18'-pentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(20),2(11),7,12,14,16-hexaene]-7'-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78441369 | ChemSpider |