EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8Br3NO |
| Net Charge | 0 |
| Average Mass | 409.903 |
| Monoisotopic Mass | 406.81560 |
| SMILES | Oc1ccc(Cc2nc(Br)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C11H8Br3NO/c12-9-8(15-11(14)10(9)13)5-6-1-3-7(16)4-2-6/h1-4,15-16H,5H2 |
| InChIKey | WFENRQKTALRFAD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas sp. J010 (ncbitaxon:998465) | - | PubMed (24828288) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol (CHEBI:218817) has role antibacterial agent (CHEBI:33282) |
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol (CHEBI:218817) has role bacterial metabolite (CHEBI:76969) |
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol (CHEBI:218817) is a organobromine compound (CHEBI:37141) |
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol (CHEBI:218817) is a phenols (CHEBI:33853) |
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol (CHEBI:218817) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 4-[(3,4,5-tribromo-1H-pyrrol-2-yl)methyl]phenol |
| Synonym | Source |
|---|---|
| 4'-((3,4,5-tribromo-1H-pyrrol-2-yl)methyl)phenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 32675069 | ChemSpider |
| Citations |
|---|