EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41ClN8O11 |
| Net Charge | 0 |
| Average Mass | 677.112 |
| Monoisotopic Mass | 676.25833 |
| SMILES | C[C@H](NC(=O)[C@H]1[C@H](O)[C@H](O)C=NN1C(=O)CO)C(=O)N1NC[C@@H](Cl)C[C@@H]1C(=O)N1NC(C)(C)CC[C@H]1C(=O)N[C@@](C)(CO)C(=O)O |
| InChI | InChI=1S/C26H41ClN8O11/c1-12(30-21(42)18-19(40)16(38)9-29-35(18)17(39)10-36)22(43)33-15(7-13(27)8-28-33)23(44)34-14(5-6-25(2,3)32-34)20(41)31-26(4,11-37)24(45)46/h9,12-16,18-19,28,32,36-38,40H,5-8,10-11H2,1-4H3,(H,30,42)(H,31,41)(H,45,46)/t12-,13-,14-,15+,16+,18+,19+,26-/m0/s1 |
| InChIKey | TZYIGVVFYVFPFJ-IDMDZTOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (28489377) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Svetamycin E (CHEBI:218814) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3S)-2-[(3R,5S)-5-chloro-2-[(2S)-2-[[(3R,4S,5R)-4,5-dihydroxy-2-(2-hydroxyacetyl)-4,5-dihydro-3H-pyridazine-3-carbonyl]amino]propanoyl]diazinane-3-carbonyl]-6,6-dimethyldiazinane-3-carbonyl]amino]-3-hydroxy-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439463 | ChemSpider |