EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O6 |
| Net Charge | 0 |
| Average Mass | 494.628 |
| Monoisotopic Mass | 494.26684 |
| SMILES | C/C(=C\Cc1ccccc1)CCC(=O)/C=C/C[C@H](O)C/C(C)=C/C/C=C/C/C(=C\C(=O)O)CC(=O)O |
| InChI | InChI=1S/C30H38O6/c1-23(16-18-25-11-6-4-7-12-25)17-19-27(31)14-9-15-28(32)20-24(2)10-5-3-8-13-26(21-29(33)34)22-30(35)36/h3-4,6-12,14,16,21,28,32H,5,13,15,17-20,22H2,1-2H3,(H,33,34)(H,35,36)/b8-3+,14-9+,23-16+,24-10+,26-21+/t28-/m0/s1 |
| InChIKey | DLWDWAOHZVEUQO-LAUMHEIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum (ncbitaxon:56) | - | DOI (10.1002/jlac.199619961026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ripostatin C (CHEBI:218760) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-3-[(2E,5E,8S,10E,15E)-8-hydroxy-6,15-dimethyl-12-oxo-17-phenylheptadeca-2,5,10,15-tetraenyl]pent-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 8942834 | ChemSpider |