EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O5 |
| Net Charge | -2 |
| Average Mass | 230.220 |
| Monoisotopic Mass | 230.09137 |
| SMILES | CC(=O)N[C@@H](CCC[C@H](N)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-5(12)11-7(9(15)16)4-2-3-6(10)8(13)14/h6-7H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/p-2/t6-,7-/m0/s1 |
| InChIKey | KYVLWJXMCBZDRL-BQBZGAKWSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-LL-2,6-diaminopimelate(2−) (CHEBI:18317) has functional parent pimelate(2−) (CHEBI:36165) |
| N-acetyl-LL-2,6-diaminopimelate(2−) (CHEBI:18317) is a dicarboxylic acid dianion (CHEBI:28965) |
| N-acetyl-LL-2,6-diaminopimelate(2−) (CHEBI:18317) is conjugate base of N-acetyl-LL-2,6-diaminopimelic acid (CHEBI:49004) |
| Incoming Relation(s) |
| N-acetyl-LL-2,6-diaminopimelic acid (CHEBI:49004) is conjugate acid of N-acetyl-LL-2,6-diaminopimelate(2−) (CHEBI:18317) |
| IUPAC Name |
|---|
| (2S,6S)-2-acetamido-6-aminoheptanedioate |
| Synonyms | Source |
|---|---|
| N-acetyl-L,L-2,6-diaminoheptanedioate | MetaCyc |
| N-acetyl-LL-2,6-diaminoheptanedioate | ChEBI |
| N-acetyl-L,L-2,6-diaminopimelate | MetaCyc |
| N-acetyl-LL-2,6-diaminopimelate | ChEBI |
| N-acetyl-LL-2,6-diaminopimelate dianion | ChEBI |
| N-acetyl-L,L-DAP | MetaCyc |