EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O7 |
| Net Charge | 0 |
| Average Mass | 202.118 |
| Monoisotopic Mass | 202.01135 |
| SMILES | O=C(O)/C=C\OC(=O)O/C=C\C(=O)O |
| InChI | InChI=1S/C7H6O7/c8-5(9)1-3-13-7(12)14-4-2-6(10)11/h1-4H,(H,8,9)(H,10,11)/b3-1-,4-2- |
| InChIKey | RENVOXDLGUTYIQ-CCAGOZQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dothiorella viticola (ncbitaxon:323561) | - | DOI (10.1016/j.arabjc.2018.01.014) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spencer acid (CHEBI:218745) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (Z)-3-[(Z)-2-carboxyethenoxy]carbonyloxyprop-2-enoic acid |