EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClO5 |
| Net Charge | 0 |
| Average Mass | 346.766 |
| Monoisotopic Mass | 346.06080 |
| SMILES | C[C@@H]1Cc2ccccc2C(=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H15ClO5/c1-9-6-10-4-2-3-5-11(10)13(20)7-12-16(18(23)24-9)14(21)8-15(22)17(12)19/h2-5,8-9,21-22H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | XQFBITSYAUZTRB-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia (ncbitaxon:243023) | - | DOI (10.1016/j.tetlet.2008.10.099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pochonin I (CHEBI:218737) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (7R)-1-chloro-2,4-dihydroxy-7-methyl-8,14-dihydro-7H-benzo[e][2]benzoxecine-5,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 78437610 | ChemSpider |