EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N4O4S |
| Net Charge | 0 |
| Average Mass | 372.491 |
| Monoisotopic Mass | 372.18313 |
| SMILES | [H][C@]12CS[C@@H](CCCCC(=O)NCCCC[C@H](N)C(=O)O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | BAQMYDQNMFBZNA-MNXVOIDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biocytin (CHEBI:27870) has functional parent biotin (CHEBI:15956) |
| biocytin (CHEBI:27870) has role mouse metabolite (CHEBI:75771) |
| biocytin (CHEBI:27870) is a L-lysine derivative (CHEBI:25095) |
| biocytin (CHEBI:27870) is a azabicycloalkane (CHEBI:38295) |
| biocytin (CHEBI:27870) is a monocarboxylic acid amide (CHEBI:29347) |
| biocytin (CHEBI:27870) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| biocytin (CHEBI:27870) is a thiabicycloalkane (CHEBI:38297) |
| biocytin (CHEBI:27870) is a ureas (CHEBI:47857) |
| biocytin (CHEBI:27870) is tautomer of biocytin zwitterion (CHEBI:195545) |
| Incoming Relation(s) |
| biocytinamide (CHEBI:85290) has functional parent biocytin (CHEBI:27870) |
| biocytin zwitterion (CHEBI:195545) is tautomer of biocytin (CHEBI:27870) |
| IUPAC Name |
|---|
| N6-{5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl}-L-lysine |
| Synonyms | Source |
|---|---|
| (3aS-(3aα,4β,6aα))-N6-(5-(hexahydro-2-oxo-1H-thieno(3,4-d)imidazol-4-yl)-1-oxopentyl)-L-lysine | RESID |
| Biocytin | KEGG COMPOUND |
| biotinyl-L-lysine | ChemIDplus |
| N-biotinyl-L-lysine | ChEBI |
| N6-D-biotinyl-L-lysine | ChEBI |
| Nε-biotinyl-L-lysine | ChEBI |
| Citations |
|---|