EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29NO8 |
| Net Charge | 0 |
| Average Mass | 459.495 |
| Monoisotopic Mass | 459.18932 |
| SMILES | C[C@@]1(CCC(=O)Nc2c(O)ccc(C(=O)O)c2O)C(=O)C=C[C@@]23CC(CCC21)[C@](O)(CO)C3 |
| InChI | InChI=1S/C24H29NO8/c1-22(8-7-18(29)25-19-15(27)4-3-14(20(19)30)21(31)32)16-5-2-13-10-23(16,9-6-17(22)28)11-24(13,33)12-26/h3-4,6,9,13,16,26-27,30,33H,2,5,7-8,10-12H2,1H3,(H,25,29)(H,31,32)/t13?,16?,22-,23-,24+/m0/s1 |
| InChIKey | DOYWTHZZLFTNQH-DFOWYGNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Platensimycin A5 (CHEBI:218698) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-[3-[(1S,5S,10S)-10-hydroxy-10-(hydroxymethyl)-5-methyl-4-oxo-5-tricyclo[7.2.1.01,6]dodec-2-enyl]propanoylamino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440504 | ChemSpider |