EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O6 |
| Net Charge | 0 |
| Average Mass | 352.427 |
| Monoisotopic Mass | 352.18859 |
| SMILES | CCCCC/C=C/C1=C(CO)C(=O)C[C@](O)(C/C=C(\C)C(=O)O)[C@H]1O |
| InChI | InChI=1S/C19H28O6/c1-3-4-5-6-7-8-14-15(12-20)16(21)11-19(25,17(14)22)10-9-13(2)18(23)24/h7-9,17,20,22,25H,3-6,10-12H2,1-2H3,(H,23,24)/b8-7+,13-9+/t17-,19+/m0/s1 |
| InChIKey | URCJGSIEVALIMC-SJCXCURWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Multiclavulaspecies (ncbitaxon:2506259) | - | PubMed (19117486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-[(1R,2S)-3-[(E)-hept-1-enyl]-1,2-dihydroxy-4-(hydroxymethyl)-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid (CHEBI:218697) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (E)-4-[(1R,2S)-3-[(E)-hept-1-enyl]-1,2-dihydroxy-4-(hydroxymethyl)-5-oxocyclohex-3-en-1-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24620208 | ChemSpider |