EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O3S2 |
| Net Charge | 0 |
| Average Mass | 338.454 |
| Monoisotopic Mass | 338.07588 |
| SMILES | CS[C@]1(CO)C(=O)N2c3ccccc3C[C@@]2(SC)C(=O)N1C |
| InChI | InChI=1S/C15H18N2O3S2/c1-16-12(19)14(21-2)8-10-6-4-5-7-11(10)17(14)13(20)15(16,9-18)22-3/h4-7,18H,8-9H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | VRMGNHSNVZMDQN-HUUCEWRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus cejpii (ncbitaxon:1884262) | - | PubMed (26258781) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5a,6-anhydrobisdethiobis(methylthio)gliotoxin (CHEBI:218593) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (3R,10aR)-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulanyl)-10H-pyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 40256522 | ChemSpider |