EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H23N3O2 |
| Net Charge | 0 |
| Average Mass | 217.313 |
| Monoisotopic Mass | 217.17903 |
| SMILES | NCCCCNCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H23N3O2/c11-6-2-4-8-13-7-3-1-5-9(12)10(14)15/h9,13H,1-8,11-12H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | PGPFBXMCOQNMJO-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxyhypusine (CHEBI:50038) has functional parent hypusine (CHEBI:21858) |
| deoxyhypusine (CHEBI:50038) has role human metabolite (CHEBI:77746) |
| deoxyhypusine (CHEBI:50038) is a L-lysine derivative (CHEBI:25095) |
| deoxyhypusine (CHEBI:50038) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| deoxyhypusine residue (CHEBI:91176) is substituent group from deoxyhypusine (CHEBI:50038) |
| deoxyhypusinyl group (CHEBI:50039) is substituent group from deoxyhypusine (CHEBI:50038) |
| IUPAC Name |
|---|
| N6-(4-aminobutyl)-L-lysine |
| Synonym | Source |
|---|---|
| N(6)-(4-Aminobutyl)lysine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5GG | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5809055 | Reaxys |
| CAS:82543-85-9 | ChemIDplus |
| Citations |
|---|