EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:218579 - 6-[(methoxythio)carbonyl]pyridine-2-carboxylic acid methyl ester
| Formula | C9H9NO4S |
| Net Charge | 0 |
| Average Mass | 227.241 |
| Monoisotopic Mass | 227.02523 |
| SMILES | COSC(=O)c1cccc(C(=O)OC)n1 |
| InChI | InChI=1S/C9H9NO4S/c1-13-8(11)6-4-3-5-7(10-6)9(12)15-14-2/h3-5H,1-2H3 |
| InChIKey | MXAFHAYQTYCNNT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonasspecies (ncbitaxon:306) | - | DOI (10.1016/s0040-4039(00)98731-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[(methoxythio)carbonyl]pyridine-2-carboxylic acid methyl ester (CHEBI:218579) is a aromatic carboxylic acid (CHEBI:33859) |
| 6-[(methoxythio)carbonyl]pyridine-2-carboxylic acid methyl ester (CHEBI:218579) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| methyl 6-methoxysulanylcarbonylpyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 74028724 | ChemSpider |