EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N6O11 |
| Net Charge | 0 |
| Average Mass | 604.573 |
| Monoisotopic Mass | 604.21291 |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)N[C@H](CCCN(C=O)OC(=O)c1cccc(O)c1O)C(=O)O |
| InChI | InChI=1S/C26H32N6O11/c27-26(28)29-11-3-7-16(30-22(38)14-5-1-9-18(34)20(14)36)23(39)31-17(24(40)41)8-4-12-32(13-33)43-25(42)15-6-2-10-19(35)21(15)37/h1-2,5-6,9-10,13,16-17,34-37H,3-4,7-8,11-12H2,(H,30,38)(H,31,39)(H,40,41)(H4,27,28,29)/t16-,17-/m1/s1 |
| InChIKey | JANBVBCLMZUUHR-IAGOWNOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinosynnema mirum (ncbitaxon:40567) | - | PubMed (22578145) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mirubactin (CHEBI:218566) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-[(2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-5-[(2,3-dihydroxybenzoyl)oxy-ormylamino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440503 | ChemSpider |