EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | COC(=O)c1ccc([C@H](O)[C@H](C)O)cn1 |
| InChI | InChI=1S/C10H13NO4/c1-6(12)9(13)7-3-4-8(11-5-7)10(14)15-2/h3-6,9,12-13H,1-2H3/t6-,9+/m0/s1 |
| InChIKey | XZXCYBBAXJQLFQ-IMTBSYHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marasmiellus (ncbitaxon:71896) | - | PubMed (11714225) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CJ-14,877 (CHEBI:218564) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-[(1S,2S)-1,2-dihydroxypropyl]pyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 7970104 | ChemSpider |