EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2 |
| Net Charge | 0 |
| Average Mass | 228.251 |
| Monoisotopic Mass | 228.08988 |
| SMILES | C[C@H]1C(=O)n2c(cc3ccccc32)C(=O)N1C |
| InChI | InChI=1S/C13H12N2O2/c1-8-12(16)15-10-6-4-3-5-9(10)7-11(15)13(17)14(8)2/h3-8H,1-2H3/t8-/m0/s1 |
| InChIKey | CXUNMGUSARNJTG-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus thermomutatus (ncbitaxon:41047) | - | PubMed (25421322) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4-tetrahydro-2,3-dimethyl-1,4-dioxopyrazino[1,2-a]indole (CHEBI:218552) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2,3-dimethyl-3H-pyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 12283650 | ChemSpider |