EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N2O2S2 |
| Net Charge | 0 |
| Average Mass | 354.456 |
| Monoisotopic Mass | 354.04967 |
| SMILES | O=C1N2c3ccccc3C[C@]2(S)C(=O)N2c3ccccc3C[C@]12S |
| InChI | InChI=1S/C18H14N2O2S2/c21-15-17(23)9-11-5-1-3-7-13(11)19(17)16(22)18(24)10-12-6-2-4-8-14(12)20(15)18/h1-8,23-24H,9-10H2/t17-,18-/m0/s1 |
| InChIKey | BMEBTFADGPZRQD-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/j.cclet.2017.09.006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperterzine (CHEBI:218544) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (1S,11S)-1,11-bis(sulanyl)-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4,6,8,14,16,18-hexaene-2,12-dione |