EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N12O6 |
| Net Charge | 0 |
| Average Mass | 524.543 |
| Monoisotopic Mass | 524.25678 |
| SMILES | C[C@@H]1NC(=O)[C@@H](N)CNC(=O)[C@H]([C@H]2CCN=C(N)N2)NC(=O)/C(=C/NC(N)=O)NC(=O)[C@H](CN)NC1=O |
| InChI | InChI=1S/C19H32N12O6/c1-7-13(32)28-10(4-20)15(34)29-11(6-26-19(23)37)16(35)31-12(9-2-3-24-18(22)30-9)17(36)25-5-8(21)14(33)27-7/h6-10,12H,2-5,20-21H2,1H3,(H,25,36)(H,27,33)(H,28,32)(H,29,34)(H,31,35)(H3,22,24,30)(H3,23,26,37)/b11-6-/t7-,8-,9+,10-,12-/m0/s1 |
| InChIKey | MHBQQDNEPQYCOS-CBQPQWBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix mutabilis subsp. capreolus (ncbitaxon:66854) | - | PubMed (61134) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Capreomycin IIB (CHEBI:218541) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| [(Z)-[(3S,9S,12S,15S)-15-amino-9-(aminomethyl)-3-[(6R)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-12-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-6-ylidene]methyl]urea |
| Manual Xrefs | Databases |
|---|---|
| 2298734 | ChemSpider |