EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O4 |
| Net Charge | 0 |
| Average Mass | 216.237 |
| Monoisotopic Mass | 216.11101 |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)C(N)=O |
| InChI | InChI=1S/C9H16N2O4/c1-5(2)4-6(9(14)15-3)11-8(13)7(10)12/h5-6H,4H2,1-3H3,(H2,10,12)(H,11,13)/t6-/m0/s1 |
| InChIKey | YOAIPUXWHBBNOK-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleurotus ostreatus (ncbitaxon:5322) | - | PubMed (28395537) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalamido-L-leucine methyl ester (CHEBI:218531) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-4-methyl-2-(oxamoylamino)pentanoate |
| Manual Xrefs | Databases |
|---|---|
| 78441829 | ChemSpider |