EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44N14O8 |
| Net Charge | 0 |
| Average Mass | 668.717 |
| Monoisotopic Mass | 668.34665 |
| SMILES | NCCC[C@@H](N)CC(=O)NC[C@@H]1NC(=O)[C@H](CO)NC(=O)[C@@H](N)CNC(=O)[C@H]([C@H]2CCN=C(N)N2)NC(=O)/C(=C/NC(N)=O)NC1=O |
| InChI | InChI=1S/C25H44N14O8/c26-4-1-2-11(27)6-17(41)32-8-14-20(43)35-15(9-34-25(30)47)21(44)39-18(13-3-5-31-24(29)38-13)23(46)33-7-12(28)19(42)37-16(10-40)22(45)36-14/h9,11-14,16,18,40H,1-8,10,26-28H2,(H,32,41)(H,33,46)(H,35,43)(H,36,45)(H,37,42)(H,39,44)(H3,29,31,38)(H3,30,34,47)/b15-9-/t11-,12+,13-,14+,16+,18+/m1/s1 |
| InChIKey | JNIIDKODPGHQSS-CGLFUZANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix mutabilis subsp. capreolus (ncbitaxon:66854) | - | PubMed (61134) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Capreomycin IA (CHEBI:218527) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3R)-3,6-diamino-N-[[(2S,5S,8Z,11S,15S)-15-amino-11-[(6R)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]-8-[(carbamoylamino)methylidene]-2-(hydroxymethyl)-3,6,9,12,16-pentaoxo-1,4,7,10,13-pentazacyclohexadec-5-yl]methyl]hexanamide |
| Manual Xrefs | Databases |
|---|---|
| 78438679 | ChemSpider |